Identification |
Name: | 1-Tetradecanol,1,1',1''-triester with boric acid (H3BO3) |
Synonyms: | 1-Tetradecanol,triester with boric acid (H3BO3) (8CI,9CI); Tris(tetradecyl)borate |
CAS: | 23162-15-4 |
EINECS: | 245-467-3 |
Molecular Formula: | C42H87 B O3 |
Molecular Weight: | 650.95 |
InChI: | InChI=1/C42H87BO3/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-44-43(45-41-38-35-32-29-26-23-20-17-14-11-8-5-2)46-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h4-42H2,1-3H3 |
Molecular Structure: |
![(C42H87BO3) 1-Tetradecanol,triester with boric acid (H3BO3) (8CI,9CI); Tris(tetradecyl)borate](https://img1.guidechem.com/chem/e/dict/48/23162-15-4.jpg) |
Properties |
Flash Point: | 269.3°C |
Boiling Point: | 569.4°Cat760mmHg |
Density: | 0.853g/cm3 |
Refractive index: | 1.45 |
Flash Point: | 269.3°C |
Safety Data |
|
![](/images/detail_15.png) |