Identification |
Name: | Ethanol,2-(dicyclohexylamino)-, 1,1',1''-triester with boric acid (H3BO3) |
Synonyms: | Ethanol,2-(dicyclohexylamino)-, borate (7CI,8CI); Ethanol, 2-(dicyclohexylamino)-,triester with boric acid (H3BO3) (9CI) |
CAS: | 7539-58-4 |
EINECS: | 231-414-1 |
Molecular Formula: | C42H78 B N3 O3 |
Molecular Weight: | 683.89802 |
InChI: | InChI=1/C42H78BN3O3/c1-7-19-37(20-8-1)44(38-21-9-2-10-22-38)31-34-47-43(48-35-32-45(39-23-11-3-12-24-39)40-25-13-4-14-26-40)49-36-33-46(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h37-42H,1-36H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 389.1°C |
Boiling Point: | 719.7°C at 760 mmHg |
Density: | 1.03g/cm3 |
Refractive index: | 1.53 |
Flash Point: | 389.1°C |
Safety Data |
|
|