| Identification |
| Name: | Sodium butyrate |
| Synonyms: | Butyric acid, sodium salt; Butanoic acid, sodium salt; Butanoicacid,sodiumsalt; Butanoicacidsodiumsalt; butyratesodium; sodiumpropanecarboxylate; BUTYRIC ACID SODIUM SALT; BUTYRIC ACID NA; SODIUM N-BUTYLATE; SODIUM N-BUTYRATE; SODIUM BUTANOATE; N-BUTYRIC ACID SODIUM SALT; NAB; N-BUTYRIC ACID, SODIUM; SODIUMBUTYRATE,USP; Natriumbutyrat |
| CAS: | 156-54-7 |
| EINECS: | 205-857-6 |
| Molecular Formula: | C4H7NaO2 |
| Molecular Weight: | 110.09 |
| InChI: | InChI=1/C4H8O2.Na/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2820 |
| Density: | 0.987g/cm3 |
| Stability: | Stable. Incompatible with strong acids. |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | white powder. |
| HS Code: | 29156019 |
| Biological Activity: | Histone deacetylase inhibitor. Restores contextual memory in a transgenic mouse model of Alzheimer's disease. Shown to induce pancreatic progenitor formation. Directs the differentiation of mouse embryonic stem cells into hepatocytes when used in combination with the cytokine Activin A. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
