| Identification | |
| Name: | Methyl butyrate |
| Synonyms: | methyl n-butanoate; |
| CAS: | 623-42-7 |
| EINECS: | 210-792-1 |
| Molecular Formula: | C5H10O2 |
| Molecular Weight: | 102.1317 |
| InChI: | InChI=1S/C5H10O2/c1-3-4-5(6)7-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1237 |
| Density: | 0.897 |
| Stability: | Stable. Flammable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | 1.385-1.39 |
| Water Solubility: | moderate Stability Stable. Flammable. Incompatible with strong bases,strong oxidizing agents. Toxicology Harmful if inhaled. Skin, eye and respiratory irritant. Toxicity data |
| Solubility: | moderate
|
| Appearance: | colorless clear liquid |
| Specification: | colourless liquid Safety Statements:16-26-36 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
