Identification |
Name: | Isobutyl butyrate |
Synonyms: | Butyricacid, isobutyl ester (6CI,7CI,8CI);2-Methylpropyl butanoate;2-Methylpropylbutyrate;Isobutyl butanoate;Isobutyl n-butyrate;NSC406938; |
CAS: | 539-90-2 |
EINECS: | 208-729-8 |
Molecular Formula: | C8H16O2 |
Molecular Weight: | 144.21 |
InChI: | InChI=1/C8H16O2/c1-4-5-8(9)10-6-7(2)3/h7H,4-6H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3272 3 |
Density: | 0.861 |
Refractive index: | 1.405 |
Appearance: | Colorless to pale yellow liquid with banana-pineapple-pear sweet odor |
Packinggroup: | III |
Safety Data |
|
 |