| Identification | |
| Name: | isobutyl formate |
| Synonyms: | Isobutyl methanoate; Tertyl formate; Formic acid isobutyl ester |
| CAS: | 542-55-2 |
| EINECS: | 208-818-1 |
| Molecular Formula: | C5H10O2 |
| Molecular Weight: | 102.13 |
| InChI: | InChI=1/C5H10O2/c1-5(2)3-7-4-6/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2393 3 |
| Density: | 0.885 |
| Refractive index: | 1.386 |
| Appearance: | COLORLESS LIQUID |
| Specification: |
Isobutyl formate (542-55-2),which also can be called for 2-Methyl-1-propyl formate ; 2-Methyl-1-propylformate ; 2-Methylpropylmethanoate ; Formic acid,2-methylpropyl ester ; Formicacid,2-methylpropylester ; Formicacid2-methylpropylester ; Isobutylester kyseliny mravenci ; Isobutylesterkyselinymravenci .When Isobutyl formate (542-55-2) was heated,it emits acrid smoke and fumes. Isobutyl formate (542-55-2) is a clear colourless to light yellow liquid and it's vapors may be narcotic and irritating in high concentrations.It's soluble in water.Be attention of this chemical is highly flammable. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
Xi:Irritant
|
 |
|
