| Identification | |
| Name: | Benzaldehyde,2-fluoro-4-nitro- |
| Synonyms: | 2-Fluoro-4-nitrobenzaldehyde;4-Nitro-2-fluorobenzaldehyde; |
| CAS: | 157701-72-9 |
| Molecular Formula: | C7H4FNO3 |
| Molecular Weight: | 169.1099632 |
| InChI: | InChI=1/C7H4FNO3/c8-7-3-6(9(11)12)2-1-5(7)4-10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.443g/cm3 |
| Refractive index: | 1.59 |
| Specification: |
The CAS register number of 2-Fluoro-4-nitrobenzaldehyde is 157701-72-9. It also can be called as Benzaldehyde,2-fluoro-4-nitro- and the systematic name about this chemical is 2-fluoro-4-nitrobenzaldehyde. The molecular formula about this chemical is C7H4FNO3 and molecular weight is 169.11. It belongs to the Aromatic Aldehydes & Derivatives (substituted). Physical properties about 2-Fluoro-4-nitrobenzaldehyde are: (1)ACD/LogP: 1.61; (2)ACD/LogD (pH 5.5): 1.61; (3)ACD/LogD (pH 7.4): 1.61; (4)ACD/BCF (pH 5.5): 9.8; (5)ACD/BCF (pH 7.4): 9.8; (6)ACD/KOC (pH 5.5): 178.25; (7)ACD/KOC (pH 7.4): 178.25; (8)#H bond acceptors: 4; (9)#Freely Rotating Bonds: 2; (10)Polar Surface Area: 62.89Å2; (11)Index of Refraction: 1.59; (12)Molar Refractivity: 39.54 cm3; (13)Molar Volume: 117.1 cm3; (14)Polarizability: 15.67x10-24cm3; (15)Surface Tension: 52.2 dyne/cm; (16)Enthalpy of Vaporization: 54.17 kJ/mol; (17)Boiling Point: 301.5 °C at 760 mmHg; (18)Vapour Pressure: 0.00105 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
