| Identification |
| Name: | 2,4-Difluorobenzoic acid |
| Synonyms: | 2,4-Difluorobenzoic;2,4-Difluorobenzoic acid and the derivatives;2,4-Difluorobenzoicacid;2,4-Difluorobenzoic acid and the derivatives; |
| CAS: | 1583-58-0 |
| EINECS: | 216-430-9 |
| Molecular Formula: | C7H4F2O2 |
| Molecular Weight: | 158.1 |
| InChI: | InChI=1/C7H4F2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.432 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | SOLUBLE |
| Solubility: | soluble in water |
| Appearance: | white to light yellow crystal powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
