| Identification | |
| Name: | 2,5-Difluorobenzoic acid |
| Synonyms: | 2,5-difluorobenzoate;2,5-Difluorobenzoicacid; |
| CAS: | 2991-28-8 |
| EINECS: | 221-060-6 |
| Molecular Formula: | C7H4F2O2 |
| Molecular Weight: | 158.1 |
| InChI: | InChI=1/C7H4F2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.432 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | White to light yellow powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Pharmaceutical intermediate. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
