Identification |
Name: | 2,6-Difluorobenzoic acid |
Synonyms: | 2,6-Difluorobonzoicacid;2,6-difluoro benzoic acid;3-09-00-01330 (Beilstein Handbook Reference);Benzoic acid, 2,6-difluoro-;2,6-difluorobenzoate; |
CAS: | 385-00-2 |
EINECS: | 206-856-3 |
Molecular Formula: | C7H4F2O2 |
Molecular Weight: | 158.1 |
InChI: | InChI=1/C7H4F2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) |
Molecular Structure: |
 |
Properties |
Density: | 1.432 g/cm3 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Water Solubility: | soluble |
Solubility: | Soluble in water |
Appearance: | White to light yellow crystal powder |
HS Code: | 29163900 |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |