| Identification | |
| Name: | META-CRESOLCOMPOUNDWITHPARA-CRESOL |
| Synonyms: | META-CRESOLCOMPOUNDWITHPARA-CRESOL |
| CAS: | 15831-10-4 |
| Molecular Formula: | C7H8O |
| Molecular Weight: | 108.13782 |
| InChI: | InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 11-12 deg C |
| Flash Point: | 86.1°C |
| Boiling Point: | 202.3°Cat760mmHg |
| Density: | 1.038g/cm3 |
| Solubility: | In solutions of fixed alkali hydroxides; miscible in alcohol; chloroform; ether Miscible in ethanol, ether, and acetone 2.5% IN MINERAL OIL In water, 2.27X10+4 mg/L at 25 deg C. |
| Flash Point: | 86.1°C |
| Color: | Colorless, yellowish, brownish-yellow, or pinkish liquid Colorless to yellow liquid [Note: A solid below 54 degrees F]. |
| Safety Data | |
 |
|
