| Identification | |
| Name: | 3-Fluoro-4-chlorobenzyl chloride |
| Synonyms: | 1-Chlor-4-(chlormethyl)-2-fluorbenzol;Benzene, 1-chloro-4-(chloromethyl)-2-fluoro-;1-Chloro-4-(chloromethyl)-2-fluorobenzene; |
| CAS: | 160658-68-4 |
| Molecular Formula: | C7H5Cl2F |
| Molecular Weight: | 179.02 |
| InChI: | InChI=1/C7H5Cl2F/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 88.2°C |
| Boiling Point: | 213.7°Cat760mmHg |
| Density: | 1.343g/cm3 |
| Refractive index: | 1.525 |
| Specification: |
The 3-Fluoro-4-chlorobenzyl chloride with the cas number 160658-68-4, is also called 1-chloro-4-(chloromethyl)-2-fluorobenzene. The product can be supplied by the following suppliers: (1)BePharm,Ltd.; (2)Wuhan Chemwish Technology Co., Ltd.; (3)Capot Chemical Co., Ltd.; (4)Shanghai Sinch Parmaceuticals Tech. Co. Ltd.; (5)ChemiK Co., Ltd.. The properties of the chemical are: (1)ACD/LogP: 3.24; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.24; (4)ACD/LogD (pH 7.4): 3.24; (5)ACD/BCF (pH 5.5): 171.67; (6)ACD/BCF (pH 7.4): 171.67; (7)ACD/KOC (pH 5.5): 1384.2; (8)ACD/KOC (pH 7.4): 1384.2; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 0Å2; (13)Index of Refraction: 1.525; (14)Molar Refractivity: 40.9 cm3; (15)Molar Volume: 133.2 cm3; (16)Polarizability: 16.21×10-24cm3; (17)Surface Tension: 35.5 dyne/cm; (18)Enthalpy of Vaporization: 43.17 kJ/mol; (19)Vapour Pressure: 0.236 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 88.2°C |
| Safety Data | |
 |
|
