| Identification | |
| Name: | 2-Chlorobenzyl chloride |
| Synonyms: | OCBC; alpha,2-Dichlorotoluene; 1-chloro-2-(chloromethyl)-Benzene; o-chlorobenzyl chloride; Sofac; SOLFAC; SOLFAC(R); tempo 2; (r,s)-alpha-cyano-4-fluoro-3-phenoxybenzyl-(1r,s)-cis,trans-3-(2,2-dichlorovin; (rs)-alpha-cyano-4-fluoro-3-phenoxybenzyl(1rs,3rs:1rs,3sr)-3-(2,2-dichloro; 2-(2,2-dichlorovinyl)-3,3-dimethyl-cyclopropanecarboxylicaciesterwith(4; 2-(2,2-dichlorovinyl)-3,3-dimethyl-cyclopropanecarboxylicaciesterwith(4-fluoro-3-phenoxyphenyl)hydroxyacetonitrile; ortho-chlorobenzylchloride |
| CAS: | 611-19-8 |
| EINECS: | 210-258-8 |
| Molecular Formula: | C7H6Cl2 |
| Molecular Weight: | 161.03 |
| InChI: | InChI=1/C7H6Cl2/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2235 |
| Density: | 1.274 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.558-1.560 |
| Water Solubility: | insoluble |
| Solubility: | Water Solubility : insoluble |
| Appearance: | Clear, colorless to pale yellow liquid. |
| Specification: |
?2-Chlorobenzyl chloride (CAS NO.611-19-8) is also called as 1-Chloro-2-(chloromethyl)benzene?;?Ortho-alpha-dichlorotoluene ; alpha,2-Dichlorotoluene ; alpha,o-Dichlorotoluene ; o-Chlorobenzyl chloride ; Benzene, 1-chloro-2-(chloromethyl)- ; Toluene, alpha,o-dichloro- (8CI) ; alpha,2-Dichlorotoluene ; Toluene, o,alpha-dichloro- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
