| Identification | |
| Name: | Acetic acid,2-[(methoxythioxomethyl)thio]- |
| Synonyms: | Aceticacid, [(methoxythioxomethyl)thio]- (9CI); Carbonic acid, dithio-, O-methylester, S-ester with mercaptoacetic acid (8CI); Acetic acid, mercapto-, O-methyldithiocarbonate (8CI); 2-[(1-Methoxy-1-thioxomethyl)thio]acetic acid |
| CAS: | 16323-12-9 |
| EINECS: | 240-398-5 |
| Molecular Formula: | C4H6 O3 S2 |
| Molecular Weight: | 166.21864 |
| InChI: | InChI=1/C4H6O3S2/c1-7-4(8)9-2-3(5)6/h2H2,1H3,(H,5,6) |
| Molecular Structure: | ![(C4H6O3S2) Aceticacid, [(methoxythioxomethyl)thio]- (9CI); Carbonic acid, dithio-, O-methylester, S-ester with ...](https://img1.guidechem.com/chem/e/dict/3/16323-12-9.jpg) |
| Properties | |
| Flash Point: | 136.3°C |
| Boiling Point: | 301.8°Cat760mmHg |
| Density: | 1.451g/cm3 |
| Refractive index: | 1.6 |
| Flash Point: | 136.3°C |
| Safety Data | |
 |
|
