| Identification | |
| Name: | 4-Pyrimidinamine,6-chloro-2-methyl- |
| Synonyms: | Pyrimidine, 4-amino-6-chloro-2-methyl- (6CI,7CI,8CI);2-Methyl-4-chloro-6-aminopyrimidine; 4-Amino-6-chloro-2-methylpyrimidine; 6-Chloro-2-methyl-4-pyrimidinamine;NSC 145903 |
| CAS: | 1749-68-4 |
| Molecular Formula: | C5H6 Cl N3 |
| Molecular Weight: | 143.57 |
| InChI: | InChI=1/C5H6ClN3/c1-3-8-4(6)2-5(7)9-3/h2H,1H3,(H2,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.594°C |
| Boiling Point: | 269.176°C at 760 mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
4-Amino-6-chloro-2-methylpyrimidine , with CAS number of 1749-68-4, can be called 4-pyrimidinamine, 6-chloro-2-methyl- ; 6-chloro-2-methylpyrimidin-4-amine 6-Chloro-2-Methyl-4-Pyrimidinamine ; 6-Chloro-2-methyl-pyrimidin-4-ylamine . |
| Flash Point: | 116.594°C |
| Safety Data | |
 |
|
