| Identification | |
| Name: | 2-Pyrimidinamine,4-chloro-6-methyl- |
| Synonyms: | Pyrimidine,2-amino-4-chloro-6-methyl- (6CI,7CI,8CI);2-Amino-4-chloro-6-methylpyrimidine;4-Chloro-6-methyl-2-pyrimidinamine;4-Chloro-6-methylpyrimidin-2-ylamine;AM;AM (nitrification inhibitor);NSC23661;NSC 7892; |
| CAS: | 5600-21-5 |
| EINECS: | 227-018-3 |
| Molecular Formula: | C5H6ClN3 |
| Molecular Weight: | 143.57 |
| InChI: | InChI=1/C5H6ClN3/c1-3-2-4(6)9-5(7)8-3/h2H,1H3,(H2,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.349 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.6 |
| Appearance: | brown to light yellow powder |
| HS Code: | 29335995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Nitrification inhibitor. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
