| Identification | |
| Name: | FC 681 |
| Synonyms: | FC 681;alpha-Ethyl-4-methyl-1-piperazineacetic acid mesityl ester dihydrochloride;1-Piperazineacetic acid, alpha-ethyl-4-methyl-, mesityl ester, dihydrochloride;2,4,6-trimethylphenyl 2-(4-methylpiperazin-1-yl)butanoate dihydrochloride;AC1L3SYM;AC1Q3B1J;AR-1D3132;LS-110050;(2,4,6-trimethylphenyl) 2-(4-methylpiperazin-1-yl)butanoate dihydrochloride |
| CAS: | 1940-89-2 |
| Molecular Formula: | C18H28N2O2 . 2ClH |
| Molecular Weight: | 377.349 |
| InChI: | InChI=1/C18H28N2O2.2ClH/c1-6-16(20-9-7-19(5)8-10-20)18(21)22-17-14(3)11-13(2)12-15(17)4;;/h11-12,16H,6-10H2,1-5H3;2*1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 198.7°C |
| Boiling Point: | 405°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
FC 681 ,its cas register number is 1940-89-2. It also can be called 1-Piperazineacetic acid, alpha-ethyl-4-methyl-, mesityl ester, dihydrochloride ; and alpha-Ethyl-4-methyl-1-piperazineacetic acid mesityl ester dihydrochloride . |
| Flash Point: | 198.7°C |
| Safety Data | |
 |
|
