| Identification | |
| Name: | FC 657 |
| Synonyms: | N,N-Diethylglycine mesityl ester hydrochloride;FC 657;GLYCINE, N,N-DIETHYL-, MESITYL ESTER, HYDROCHLORIDE;2014-32-6;AC1L27H8;LS-72483;diethyl-[2-oxo-2-(2,4,6-trimethylphenoxy)ethyl]azanium chloride;N,N-diethyl-2-oxo-2-(2,4,6-trimethylphenoxy)ethanaminium chloride |
| CAS: | 2014-32-6 |
| Molecular Formula: | C15H23NO2 . ClH |
| Molecular Weight: | 285.8096 |
| InChI: | InChI=1/C15H23NO2.ClH/c1-6-16(7-2)10-14(17)18-15-12(4)8-11(3)9-13(15)5;/h8-9H,6-7,10H2,1-5H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 107.3°C |
| Boiling Point: | 330°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
FC 657 ,its cas register number is 2014-32-6. It also can be called Glycine, N,N-diethyl-, mesityl ester, hydrochloride ; and N,N-Diethylglycine mesityl ester hydrochloride . |
| Flash Point: | 107.3°C |
| Safety Data | |
 |
|
