| Identification | |
| Name: | FC 660 |
| Synonyms: | L-N,N-Diethylalanine mesityl ester hydrochloride;FC 660;ALANINE, N,N-DIETHYL-, MESITYL ESTER, L-, HYDROCHLORIDE;AC1L2896;LS-16035;diethyl-[1-oxo-1-(2,4,6-trimethylphenoxy)propan-2-yl]azanium chloride;2173-47-9 |
| CAS: | 2173-47-9 |
| Molecular Formula: | C16H25NO2 . ClH |
| Molecular Weight: | 299.8361 |
| InChI: | InChI=1/C16H25NO2.ClH/c1-7-17(8-2)14(6)16(18)19-15-12(4)9-11(3)10-13(15)5;/h9-10,14H,7-8H2,1-6H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 106.8°C |
| Boiling Point: | 341.1°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
FC 660 ,its cas register number is 2173-47-9. It also can be called L-N,N-Diethylalanine mesityl ester hydrochloride ; and Alanine, N,N-diethyl-, mesityl ester, L-, hydrochloride . |
| Flash Point: | 106.8°C |
| Safety Data | |
 |
|
