| Identification | |
| Name: | 4,9,10-Trimethyl-1,2-benzanthracene |
| Synonyms: | 6,7,12-Trimethylbenz[a]anthracene |
| CAS: | 20627-33-2 |
| Molecular Formula: | C21H18 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C21H18/c1-13-12-16-8-4-5-11-19(16)21-15(3)18-10-7-6-9-17(18)14(2)20(13)21/h4-12H,1-3H3 |
| Molecular Structure: | ![(C21H18) 6,7,12-Trimethylbenz[a]anthracene](https://img.guidechem.com/crawlimg/20627-33-2.png) |
| Properties | |
| Flash Point: | 240°C |
| Boiling Point: | 482.9°C at 760 mmHg |
| Density: | 1.123g/cm3 |
| Refractive index: | 1.712 |
| Specification: |
4,9,10-Trimethyl-1,2-benzanthracene ,its CAS number is 20627-33-2,it can be called Benz(a)anthracene, 6,7,12-trimethyl- ; 6,7,12-Trimethylbenz(a)anthracene and 4,9,10-Trimethyl-1,2-benzanthracene . |
| Flash Point: | 240°C |
| Safety Data | |
 |
|
