Identification |
Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one,3',4',5',6'-tetrahydroxy- |
Synonyms: | Gallein(6CI,8CI);Alizarine violet;C.I. 45445;C.I. Mordant Violet 25;Mordant Violet25;NSC 56445;NSC 622478;NSC 8668;Pyrogallolphthalein; |
CAS: | 2103-64-2 |
EINECS: | 218-272-6 |
Molecular Formula: | C20H12 O7 |
Molecular Weight: | 364.31 |
InChI: | InChI=1/C20H12O7/c21-13-7-5-11-17(15(13)23)26-18-12(6-8-14(22)16(18)24)20(11)10-4-2-1-3-9(10)19(25)27-20/h1-8,21-24H |
Molecular Structure: |
|
Properties |
Flash Point: | 255.2°C |
Boiling Point: | 687.4°Cat760mmHg |
Density: | 1.81g/cm3 |
Refractive index: | 1.865 |
Biological Activity: | Inhibitor of G protein β γ subunit-dependent signaling. Blocks PI 3-kinase and Rac1 activation in HL60 cells and chemotaxis in HL60 differentiated cells. |
Flash Point: | 255.2°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
|