| Identification | |
| Name: | Ethylmercuric cysteine |
| Synonyms: | Ethylmercuric cysteine;MERCURY, ETHYL(HYDROGEN CYSTEINATO)-;Mercurate(1-), (L-cysteinato(2-)-N,S)ethyl-, hydrogen;AC1L1JMV;LS-89778;2-amino-3-hydroxy-3-oxopropane-1-thiolate; ethylmercury(1+);21082-50-8 |
| CAS: | 21082-50-8 |
| Molecular Formula: | C5H11NO2S . Hg |
| Molecular Weight: | 349.8013 |
| InChI: | InChI=1/C3H7NO2S.C2H5.Hg/c4-2(1-7)3(5)6;1-2;/h2,7H,1,4H2,(H,5,6);1H2,2H3;/q;;+1/p-1/rC3H7NO2S.C2H5Hg/c4-2(1-7)3(5)6;1-2-3/h2,7H,1,4H2,(H,5,6);2H2,1H3/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.5°C |
| Boiling Point: | 293.9°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Ethylmercuric cysteine , its cas register number is 21082-50-8. It also can be called Mercurate(1-), (L-cysteinato(2-)-N,S)ethyl-, hydrogen ; Mercury, ethyl(hydrogen cysteinato)- . When heated to decomposition it emits very toxic fumes of NOx, SOx, and Hg. And Ethylmercuric cysteine (CAS NO.21082-50-8) is toxic if swallowed. |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 131.5°C |
| Safety Data | |
 |
|
