| Identification | |
| Name: | 2-Propenoic acid,ethenyl ester |
| Synonyms: | Acrylicacid, vinyl ester (6CI,7CI,8CI); NSC 4768; Vinyl acrylate |
| CAS: | 2177-18-6 |
| EINECS: | 218-538-1 |
| Molecular Formula: | C5H6 O2 |
| Molecular Weight: | 98.11 |
| InChI: | InChI=1/C5H6O2/c1-3-5(6)7-4-2/h3-4H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3286 3/PG 2 |
| Flash Point: | 13.5°C |
| Boiling Point: | 91.5°Cat760mmHg |
| Density: | 0.936g/cm3 |
| Refractive index: | n20/D 1.432(lit.) |
| Specification: |
Ethyl 2-propenoate with CAS registry number of 2177-18-6 is also known as Vinyl acrylate ; 2-Propenoicacid,ethenylester ; Acrylic acid,vinyl ester ; Acrylicacid,vinylester ; Ethenyl2-propenoate ; Vinyl acrylate98% ; Vinyl acrylate,stabilized,98+% ; 3-Oxahexa-1,5-diene-4-one . It is a colorless clear liquid. Ethyl 2-propenoate is prone to polymerization because it contains a vinyl double bond, so this compound is suitable for manufacture of homopolymer and copolymer which can be used as coatings and protective colloid. |
| Flash Point: | 13.5°C |
| Safety Data | |
 |
|
