Identification |
Name: | b-D-Glucopyranosiduronic acid,2-carboxyphenyl, 6-methyl ester, triacetate (9CI) |
Synonyms: | 2-Carboxyphenyl -D-Glucopyranosiduronic Acid 6-Methyl Ester Triacetate;Methyl 1-(2-Carboxyphenyl)-2,3,4-tri-O-acetyl--D-glucopyranuronate |
CAS: | 221287-90-7 |
Molecular Formula: | C20H22 O12 |
Molecular Weight: | 0 |
InChI: | InChI=1/C20H22O12/c1-9(21)28-14-15(29-10(2)22)17(30-11(3)23)20(32-16(14)19(26)27-4)31-13-8-6-5-7-12(13)18(24)25/h5-8,14-17,20H,1-4H3,(H,24,25)/t14-,15-,16?,17-,20+/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 185.986°C |
Boiling Point: | 549.893°C at 760 mmHg |
Density: | 1.415g/cm3 |
Refractive index: | 1.548 |
Flash Point: | 185.986°C |
Usage: | An intermediate in the synthesis of the metabolite of Nitazoxanide |
Safety Data |
|
|