| Identification |
| Name: | m-Amino Thiophenol |
| Synonyms: | 3-Aminothiophenol; 3-Aminobenzenethiol |
| CAS: | 22948-02-3 |
| EINECS: | 245-344-4 |
| Molecular Formula: | C6H7NS |
| Molecular Weight: | 125.19 |
| InChI: | InChI=1/C6H7NS/c7-5-2-1-3-6(8)4-5/h1-4,8H,7H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3267 |
| Melting Point: | 97 C |
| Density: | 1.179 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.656-1.658 |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | pale-yellow liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Stench |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
