| Identification | |
| Name: | p-Hydroxy Thiophenol |
| Synonyms: | 4-Mercaptophenol; Hydroxythiophenol,94%; 4-Hydroxythiophenol,(4-Mercaptophenol); 4-(Benzylthio)phenol, polymer-supported; 4-Hydroxythiophenol |
| CAS: | 637-89-8 |
| EINECS: | 211-307-6 |
| Molecular Formula: | C6H6OS |
| Molecular Weight: | 126.17 |
| InChI: | InChI=1/C6H6OS/c7-5-1-3-6(8)4-2-5/h1-4,7-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.255 g/cm3 |
| Stability: | Stability Air sensitive. Incompatible with oxidizing agents. |
| Refractive index: | 1.6153 (22 C) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white solid or colourless liquid with a foul smell |
| Specification: |
? 4-Mercaptophenol , with CAS number of 637-89-8, can be called Phenol,p-mercapto- (6CI,7CI,8CI) ; 4-Hydroxybenzenethiol ; Monothiohydroquinone ; Thiohydroquinone ; p-Hydroxybenzenethiol ; p-Hydroxythiophenol ; p-Mercaptophenol .?It is stored in a cool, dry place with?a tightly closed container. 4-Mercaptophenol (CAS NO.637-89-8) is used for the synthesize of methasulfocarb and used as a pharmaceutical intermediate. |
| Packinggroup: | III |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
