| Identification | |
| Name: | 4H-1,3-Benzoxazin-4-one,6,8-dichloro-2,3-dihydro-2-thioxo- |
| Synonyms: | 2H-1,3-Benzoxazine-2,4(3H)-dione,6,8-dichloro-2-thio- (8CI) |
| CAS: | 23611-67-8 |
| Molecular Formula: | C8H3 Cl2 N O2 S |
| Molecular Weight: | 248.08 |
| InChI: | InChI=1/C8H3Cl2NO2S/c9-3-1-4-6(5(10)2-3)13-8(14)11-7(4)12/h1-2H,(H,11,12,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.74g/cm3 |
| Refractive index: | 1.719 |
| Specification: |
6,8-Dichloro-dihydro-1,3-benzoxazine-2-thione-4-one , its cas register number is 23611-67-8. It also can be called 6,8-Dichloro-dihydro-1,3-benzoxazine-2-thione-4-one . When heated to decomposition it emits toxic vapors of NOx, SOx, and Cl−. |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
