| Identification | |
| Name: | Anthracene,9-(bromomethyl)- |
| Synonyms: | 9-Bromomethylanthracene |
| CAS: | 2417-77-8 |
| Molecular Formula: | C15H11 Br |
| Molecular Weight: | 271.17 |
| InChI: | InChI=1/C15H11Br/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 209°C |
| Boiling Point: | 411.7°Cat760mmHg |
| Density: | 1.448g/cm3 |
| Refractive index: | 1.728 |
| Specification: |
9-Decenyl acetate (CAS NO.2417-77-8) is a toxic chemecal, flammable,thermal decomposition would release toxic combustion gases bromide,it chould be stored in low temperature, ventilation, drying environmental conditions,separated with food and raw materials, besides water, carbon oxides and oxidation of toxic carbon dioxide, dry powder, sand, water mist fire extinguishing agent can be used if emergency. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 209°C |
| Safety Data | |
 |
|
