| Identification |
| Name: | Methyl vinyl ether/maleic acid copolymer |
| Synonyms: | Vinylmethyl ether-maleic acid polymer;Methyl vinyl ether-maleic acid polymer;Maleic acid-vinyl methyl ether polymers;Poly (maleic acid-methyl vinyl ether);Maleic acid-methyl vinyl ether polymers;2-Butenedioic acid (Z)-, polymer with methoxyethene;Gantrez S 93;Maleic acid-vinylmethyl ether polymer;2-Butenedioic acid (2Z)-,polymers,polymer with methoxyethene;Gantrez AT 795;Methyl vinyl ether-maleic acid copolymer;Ethene, methoxy-, polymer with (Z)-2-butenedioic acid;Maleic acid, polymer with methyl vinyl ether;Maleic acid-methyl vinyl ether copolymer;Maleic acid-methyl vinyl ether polymer;Gantrez HY-H; |
| CAS: | 25153-40-6 |
| Molecular Formula: | (C4H4O4.C3H6O)x |
| Molecular Weight: | 174.1513 |
| InChI: | InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
| Molecular Structure: |
 |
| Properties |
| Density: | g/cm3 |
| Appearance: | powder |
| Safety Data |
| |
 |
