| Identification | |
| Name: | Acrylic acid maleic acid copolymer |
| Synonyms: | MA/AA,MA/AA --Copolymer of Maleic and Acylic Acid;furan-2,5-dione; prop-2-enoic acid;Paama;2-Propenoic acid,polymers,polymer with 2,5-furandione;Copolymer of Maleic and Acylic Acid (MA/AA);Acrylic acid maleic anhydride copolymer; |
| CAS: | 26677-99-6 |
| Molecular Formula: | (C4H4O4)n.(C3H4O2)n |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C4H2O3.C3H4O2/c5-3-1-2-4(6)7-3;1-2-3(4)5/h1-2H;2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Flash Point: | 202 oC at 760 mmHg |
| Boiling Point: | 202 oC at 760 mmHg |
| Density: | 1.23(50%aq.) |
| Solubility: | 202 oC at 760 mmHg |
| Appearance: | pale yellow to yellow transparent liquid |
| Specification: |
? Acrylic acid maleic acid copolymer (CAS NO.26677-99-6), its Synonyms are Acrylic acid, polymer with maleic anhydride ; Paama ; Poly(acrylic acid-maleic anhydride) copolymer ; Maleic anhydride - acrylic acid copolymer ; 2,5-Furandione, polymer with 2-propenoic acid ; 2-Propenoic acid, polymer with 2,5-furandione . |
| Flash Point: | 202 oC at 760 mmHg |
| Safety Data | |
 |
|
