Identification |
Name: | Acrylic acid maleic acid copolymer |
Synonyms: | Sokalan PA 80S;Sokalan PA 70;Norasol SP 02N;Norasol 490N;Sokalan CP 12S;Sokalan CP 6;Norasol SP 02;Norasol 505N;Sokalan CP 45;Acrylic acid, maleic acid polymer;Sokalan PA 75;KH 4;2-Butenedioic acid (2Z)-,polymers,polymer with 2-propenoic acid;Maleic-acrylic acid copolymer;2-Butenedioic acid (Z)-, polymer with 2-propenoic acid;Sokalan PA 25PN; |
CAS: | 29132-58-9 |
Molecular Formula: | (C4H4O4)n.(C3H4O2)n |
Molecular Weight: | 177.16008 |
InChI: | InChI=1S/C8H7N3O2/c9-11-10-7-4-2-1-3-6(7)5-8(12)13/h1-4H,5H2,(H,12,13) |
Molecular Structure: |
 |
Properties |
Transport: | UN 3265 |
Flash Point: | 100 °C |
Density: | 1.23 (50% aq.) |
Refractive index: | n20/D 1.423 |
Appearance: | White to off-yellow crystal |
Flash Point: | 100 °C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |