| Identification |
| Name: | Benzene,1,3-diethyl-2-isothiocyanato- |
| Synonyms: | Isothiocyanicacid, 2,6-diethylphenyl ester (8CI);1,3-Diethyl-2-isothiocyanatobenzene;2,6-Diethylphenyl isothiocyanate;2,6-Diethylphenyl isothiocyante; |
| CAS: | 25343-69-5 |
| EINECS: | -0 |
| Molecular Formula: | C11H13NS |
| Molecular Weight: | 191.29 |
| InChI: | InChI=1/C11H13NS/c1-3-9-6-5-7-10(4-2)11(9)12-8-13/h5-7H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2810 |
| Density: | 0.99 g/cm3 |
| Refractive index: | 1.6005 |
| Water Solubility: | REACTS with water |
| Solubility: | REACTS with water |
| Appearance: | Colorless to Yellow Liquid |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| |
 |
