| Identification | |
| Name: | 2-hexyldecanoic acid |
| Synonyms: | Hexyldecanoicacid; 96%; 2-n-Hexyldecanoic acid |
| CAS: | 25354-97-6 |
| EINECS: | 246-885-9 |
| Molecular Formula: | C16H32O2 |
| Molecular Weight: | 256.42 |
| InChI: | InChI=1/C16H32O2/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h15H,3-14H2,1-2H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 174 C |
| Density: | 0.88 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4460 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | colourless to yellow liquid |
| Specification: |
2-Hexyldecanoic acid ,its cas register number is 25354-97-6. It also can be called Decanoic acid, 2-hexyl- ; and 2-Hexyldecansaeure . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 174 C |
| Safety Data | |
 |
|
