| Identification | |
| Name: | Potassium polyacrylate |
| Synonyms: | Arasorb 800F;2-Propenoic acid,polymers,homopolymer,potassium salt;Aridall 1125;Lopon 895;123210-63-9;potassium prop-2-enoate;Polyacrylic acid, potassium salt;Potassium Polyacrylate(K-PAM);2-Propenoic acid, homopolymer, potassium salt; |
| CAS: | 25608-12-2 |
| EINECS: | 233-473-9 |
| Molecular Formula: | (C3H6O2)n.(C3H5KO2)m |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Appearance: | White crystalline solid |
| Specification: |
?Potassium polyacrylate , its cas register number is 25608-12-2. It also can be called Acrylic acid homopolymer potassium salt ; Polyacrylic acid, potassium salt ; and 2-Propenoic acid, homopolymer, potassium salt . |
| Safety Data | |
 |
|
