Identification |
Name: | Potassium polyacrylate |
Synonyms: | Arasorb 800F;2-Propenoic acid,polymers,homopolymer,potassium salt;Aridall 1125;Lopon 895;123210-63-9;potassium prop-2-enoate;Polyacrylic acid, potassium salt;Potassium Polyacrylate(K-PAM);2-Propenoic acid, homopolymer, potassium salt; |
CAS: | 25608-12-2 |
EINECS: | 233-473-9 |
Molecular Formula: | (C3H6O2)n.(C3H5KO2)m |
Molecular Weight: | 0 |
InChI: | InChI=1/C3H4O2.K/c1-2-3(4)5;/h2H,1H2,(H,4,5);/q;+1/p-1 |
Molecular Structure: |
 |
Properties |
Appearance: | White crystalline solid |
Specification: |
?Potassium polyacrylate , its cas register number is 25608-12-2. It also can be called Acrylic acid homopolymer potassium salt ; Polyacrylic acid, potassium salt ; and 2-Propenoic acid, homopolymer, potassium salt .
|
Safety Data |
|
 |