| Identification | |
| Name: | Potassium hydrogencarbonate |
| Synonyms: | Monopotassium carbonate;EPA Pesticide Chemical Code 073508;Purple K;Potassium acid carbonate;Kaligreen;Carbonic acid,compounds,monopotassium salt;potassium hydroxyformate;Potassium hydrogen carbonate; |
| CAS: | 298-14-6 |
| EINECS: | 206-059-0 |
| Molecular Formula: | KHCO3 |
| Molecular Weight: | 100.11514 |
| InChI: | InChI=1S/CH2O3.K/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Melting Point: | 292 oC |
| Flash Point: | Not considered to be a fire hazard |
| Density: | 2.17 |
| Stability: | Stable. |
| Water Solubility: | solubler (but insoluble in alcohol) |
| Solubility: | solubler (but insoluble in alcohol) |
| Appearance: | Colorless monoclinic crystal |
| Specification: |
?Potassium Bicarbonate (CAS NO.298-14-6) bicarbonate is very rarely found in its natural form, the mineral called kalicinite. |
| Packinggroup: | Z01 |
| Flash Point: | Not considered to be a fire hazard |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
T: Toxic
F: Flammable
Xi: Irritant
|
 |
|
