| Identification | |
| Name: | 5,8,11,14-Eicosatetraenoicacid, methyl ester, (5Z,8Z,11Z,14Z)- |
| Synonyms: | 5,8,11,14-Eicosatetraenoicacid, methyl ester, (all-Z)- (8CI); Arachidonic acid, methyl ester (6CI,7CI);Methyl 5Z,8Z,11Z,14Z-eicosatetraenoate; Methylall-cis-5,8,11,14-eicosatetraenoate; Methyl arachidonate; Methylcis,cis,cis,cis-eicosa-5,8,11,14-tetraenoate |
| CAS: | 2566-89-4 |
| EINECS: | 219-900-1 |
| Molecular Formula: | C21H34 O2 |
| Molecular Weight: | 318.4935 |
| InChI: | InChI=1/C21H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-20H2,1-2H3/b8-7-,11-10-,14-13-,17-16- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3183 4 |
| Density: | 0.901 g/cm3 |
| Refractive index: | 1.485 |
| Water Solubility: | chloroform: 50 mg/mL, clear, colorless |
| Solubility: | chloroform: 50 mg/mL, clear, colorless |
| Specification: | Safety Statements:9-16-29-33-60-61-62 9:Keep container in a well-ventilated place 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 33:Take precautionary measures against static discharges 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label |
| Packinggroup: | I |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
