| Identification | |
| Name: | 5,8,11,14-Eicosatetraenoicacid, (5Z,8Z,11Z,14Z)- |
| Synonyms: | 5,8,11,14-Eicosatetraenoicacid, (all-Z)- (8CI);(all-Z)-5,8,11,14-Eicosatetraenoic acid;5,8,11,14-all-cis-Eicosatetraenoic acid;5-cis,8-cis,11-cis,14-cis-Eicosatetraenoic acid;5Z,8Z,11Z,14Z-Eicosatetraenoicacid;A 0871;Arachidonic acid;Immunocytophyte;all-cis-5,8,11,14-Eicosatetraenoic acid;cis-D5,8,11,14-Eicosatetraenoic acid; |
| CAS: | 506-32-1 |
| EINECS: | 208-033-4 |
| Molecular Formula: | C20H32O2 |
| Molecular Weight: | 304.47 |
| InChI: | InChI=1/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b7-6+,10-9+,13-12+,16-15+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 0.922 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4872 |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | Appearance:slightly yellow free-flowing liquid Transport Information: OTH Hazard Symbols:UN NO. MSDS:View |
| Appearance: | slightly yellow free-flowing liquid |
| Packinggroup: | I; II; III |
| Biological Activity: | Endogenous free fatty acid released from phospholipids by phospholipase A 2 . Important cellular signaling mediator and precursor of eicosanoids. Metabolized by lipoxygenases, cyclooxygenases and cytochrome P450 monooxygenases. |
| Color: | colorless to light yellow |
| Usage: | An unsaturated omega-6 fatty acid constituent of the phospholipids of cell membranes |
| Safety Data | |
| Hazard Symbols | |
 |
|
