| Identification |
| Name: | 5,8,11,14-Eicosatetraenoicacid, sodium salt (1:1), (5Z,8Z,11Z,14Z)- |
| Synonyms: | 5,8,11,14-Eicosatetraenoicacid, sodium salt, (5Z,8Z,11Z,14Z)- (9CI); 5,8,11,14-Eicosatetraenoic acid,sodium salt, (all-Z)-; Arachidonic acid sodium salt; Sodium arachidonate |
| CAS: | 6610-25-9 |
| Molecular Formula: | C20H32 O2 . Na |
| Molecular Weight: | 326.44871 |
| InChI: | InChI=1S/C20H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22);/q;+1/p-1/b7-6-,10-9-,13-12-,16-15-; |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -49.5ºC |
| Water Solubility: | methanol: 50 mg/mL, clear, colorless to faintly yellow |
| Solubility: | methanol: 50 mg/mL, clear, colorless to faintly yellow |
| Appearance: | white to off-white waxy solid |
| Storage Temperature: | −20°C |
| Color: | white to off-white |
| Safety Data |
| |
 |
