| Identification | |
| Name: | Benzene,1-methoxy-4-(1Z)-1-propen-1-yl- |
| Synonyms: | Anisole,p-propenyl-, (Z)- (8CI); Anisole, p-propenyl-, cis- (7CI); Benzene,1-methoxy-4-(1-propenyl)-, (Z)-; Benzene, 1-methoxy-4-(1Z)-1-propenyl- (9CI);(Z)-1-(4-Methoxyphenyl)propene; (Z)-Anethole;cis-1-(p-Methoxyphenyl)-1-propene; cis-1-(p-Methoxyphenyl)propene;cis-4-(1-Propenyl)anisole; cis-Anethole; cis-p-Anethole; cis-p-Methoxy-b-methylstyrene |
| CAS: | 25679-28-1 |
| EINECS: | 247-181-4 |
| Molecular Formula: | C10H12 O |
| Molecular Weight: | 148.22 |
| InChI: | InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 88.4°C |
| Boiling Point: | 237.5°Cat760mmHg |
| Density: | 0.959g/cm3 |
| Refractive index: | 1.545 |
| Solubility: | 1:8 IN 80% ALCOHOL; 1:1 IN 90% ETHANOL ALMOST WATER INSOL; MISCIBLE WITH CHLOROFORM & ETHER Water solubility = 1.110E-1 g/l @ 25 deg C |
| Specification: |
cis-p-Propenylanisole , its cas register number is 25679-28-1. It also can be called (Z)-anethole ; 1-[(Z)-1-Propenyl]-4-methoxybenzene ; 4-[(Z)-1-Propenyl]anisole and cis-p-Propenylanisole .When cis-p-Propenylanisole (CAS NO.25679-28-1) is heated to decomposition it emits acrid smoke and irritating fumes. |
| Packinggroup: | III |
| Flash Point: | 88.4°C |
| Color: | White crystals |
| Safety Data | |
 |
|
