| Identification | |
| Name: | Benzene,1-methoxy-4-(1E)-1-propen-1-yl- |
| Synonyms: | Anisole,p-propenyl-, (E)- (8CI);Benzene, 1-methoxy-4-(1-propenyl)-, (E)-;Benzene,1-methoxy-4-(1E)-1-propenyl- (9CI);(E)-1-(4-Methoxyphenyl)propene;(E)-1-p-Methoxyphenylpropene;(E)-Anethol;(E)-Anethole;1-Methoxy-4-[(1E)-1-propenyl]benzene;NSC 209529;trans-1-(4-Methoxyphenyl)-1-propene;trans-1-(p-Methoxyphenyl)-1-propene;trans-1-(p-Methoxyphenyl)propene;trans-1-p-Anisylpropene;trans-4-(1-Propenyl)anisole;trans-p-Anethole;trans-p-Methoxy-b-methylstyrene; |
| CAS: | 4180-23-8 |
| EINECS: | 224-052-0 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.9875 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.559-1.562 |
| Water Solubility: | practically insoluble |
| Solubility: | practically insoluble |
| Appearance: | Colorless to faint yellow liquid or white crystalline solid |
| HS Code: | 29093090 |
| Color: | White crystals |
| Usage: | Flavoring. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
