| Identification | |
| Name: | Oleic acid, compd. with butylamine (1:1) |
| Synonyms: | butylamineoleate;compd.with1-butanamine(1:1);oleicacid,compd.withbutylamine(1:1);N-BUTYLAMINE OLEATE;butylammonium oleate |
| CAS: | 26094-13-3 |
| EINECS: | 247-456-9 |
| Molecular Formula: | C18H34O2 . C4H11N |
| Molecular Weight: | 355.6 |
| InChI: | InChI=1/C18H34O2.C4H11N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-5H2,1H3/b10-9+; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 230.1°C |
| Boiling Point: | 456.8°C at 760 mmHg |
| Density: | g/cm3 |
| Specification: |
Oleic acid, compd. with butylamine (1:1) ,its cas register number is 26094-13-3. It also can be called 9-Octadecenoic acid (Z)-, compd. with 1-butanamine (1:1) ; Butylammonium oleate ;and Butylamine oleate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 230.1°C |
| Safety Data | |
 |
|
