| Identification | |
| Name: | Carbonothioic acid,anhydrosulfide with thiohypochlorous acid, O-ethyl ester |
| Synonyms: | Carbonicacid, thio-, anhydrosulfide with thiohypochlorous acid, ethyl ester (8CI);Thiohypochlorous acid, anhydrosulfide with O-ethyl thiocarbonate (8CI);Ethoxycarbonylsulfenyl chloride; Ethyl (chlorosulfenyl)formate; Ethyl(chlorothio)formate |
| CAS: | 26555-35-1 |
| EINECS: | 247-800-8 |
| Molecular Formula: | C3H5 Cl O2 S |
| Molecular Weight: | 140.5886 |
| InChI: | InChI=1/C3H5ClO2S/c1-2-6-3(5)7-4/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 48°C |
| Boiling Point: | 155.7°Cat760mmHg |
| Density: | 1.315g/cm3 |
| Refractive index: | 1.483 |
| Flash Point: | 48°C |
| Safety Data | |
 |
|
