| Identification |
| Name: | Carbonothioic acid,anhydrosulfide with (4-chlorophenyl)carbamodithioic acid, O-ethyl ester (9CI) |
| Synonyms: | Carbonicacid, thio-, anhydrosulfide with p-chlorodithiocarbanilic acid, ethyl ester(8CI) |
| CAS: | 23121-36-0 |
| Molecular Formula: | C10H10 Cl N O2 S2 |
| Molecular Weight: | 275.7749 |
| InChI: | InChI=1/C10H10ClNO2S2/c1-2-14-10(13)16-9(15)12-8-5-3-7(11)4-6-8/h3-6H,2H2,1H3,(H,12,15) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 176.1°C |
| Boiling Point: | 367.5°C at 760 mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.666 |
| Flash Point: | 176.1°C |
| Safety Data |
| |
 |
