| Identification |
| Name: | carbonothioic acid, O-ethyl S-[[(4-iodophenyl)amino]thioxomethyl] ester |
| Synonyms: | Carbonic acid, thio-, anhydrosulfide with p-iododithiocarbanilic acid, ethyl ester;Thiocarbonic acid anhydrosulfide with p-iododithiocarbanilic acid ethyl ester;AC1MHUKE;LS-52117;ethyl (4-iodophenyl)carbamothioylsulfanylformate;19079-25-5 |
| CAS: | 19079-25-5 |
| Molecular Formula: | C10H10INO2S2 |
| Molecular Weight: | 367.2264 |
| InChI: | InChI=1/C10H10INO2S2/c1-2-14-10(13)16-9(15)12-8-5-3-7(11)4-6-8/h3-6H,2H2,1H3,(H,12,15) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 195°C |
| Boiling Point: | 398.8°C at 760 mmHg |
| Density: | 1.809g/cm3 |
| Refractive index: | 1.715 |
| Flash Point: | 195°C |
| Safety Data |
| |
 |
