Identification |
Name: | carbonothioic acid, O-ethyl S-[[(2-phenylethyl)amino]thioxomethyl] ester |
Synonyms: | BRN 5958403;Carbonic acid, thio-, anhydrosulfide with phenethyldithiocarbamic acid, ethyl ester;Thiocarbonic acid anhydrosulfide with phenethyldithiocarbamic acid ethyl ester;AC1MHUKZ;ethyl phenethylcarbamothioylsulfanylformate;LS-52120;19457-13-7 |
CAS: | 19457-13-7 |
Molecular Formula: | C12H15NO2S2 |
Molecular Weight: | 269.383 |
InChI: | InChI=1/C12H15NO2S2/c1-2-15-12(14)17-11(16)13-9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,16) |
Molecular Structure: |
 |
Properties |
Flash Point: | 186.7°C |
Boiling Point: | 385°C at 760 mmHg |
Density: | 1.227g/cm3 |
Refractive index: | 1.598 |
Flash Point: | 186.7°C |
Safety Data |
|
 |