| Identification |
| Name: | carbonothioic acid, S-[[(4-bromo-3-chlorophenyl)amino]thioxomethyl] O-ethyl ester |
| Synonyms: | Thiocarbonic acid anhydrosulfide with 4-bromo-3-chlorodithiocarbanilic acid ethyl ester;Carbonic acid, thio-, anhydrosulfide with 4-bromo-3-chlorodithiocarbanilic acid, ethyl ester;AC1MHUKB;LS-52105;ethyl (4-bromo-3-chlorophenyl)carbamothioylsulfanylformate;19079-22-2 |
| CAS: | 19079-22-2 |
| Molecular Formula: | C10H9BrClNO2S2 |
| Molecular Weight: | 354.671 |
| InChI: | InChI=1/C10H9BrClNO2S2/c1-2-15-10(14)17-9(16)13-6-3-4-7(11)8(12)5-6/h3-5H,2H2,1H3,(H,13,16) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 201.9°C |
| Boiling Point: | 410.2°C at 760 mmHg |
| Density: | 1.697g/cm3 |
| Refractive index: | 1.684 |
| Flash Point: | 201.9°C |
| Safety Data |
| |
 |
