| Identification |
| Name: | (R)-12-hydroxyoleic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
| Synonyms: | Ricinoleic acid, triethanolamine salt;(R)-12-Hydroxyoleic acid, compound with 2,2',2''-nitrilotriethanol(1:1);9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);(9Z)-12-hydroxyoctadec-9-enoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| CAS: | 2755-26-2 |
| EINECS: | 220-408-4 |
| Molecular Formula: | C24H49NO6 |
| Molecular Weight: | 447.649 |
| InChI: | InChI=1/C18H34O3.C6H15NO3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;8-4-1-7(2-5-9)3-6-10/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);8-10H,1-6H2/b12-9-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 219.8°C |
| Boiling Point: | 416.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 219.8°C |
| Safety Data |
| |
 |
