| Identification | |
| Name: | (R)-12-hydroxyoleic acid, compound with morpholine (1:1) |
| Synonyms: | 9-Octadecenoic acid, 12-hydroxy-, (9Z,12R)-, compd. with morpholine (1:1);Morpholine ricinoleate;(R)-12-Hydroxyoleic acid, compound with morpholine (1:1);(9Z,12R)-12-hydroxyoctadec-9-enoic acid - morpholine (1:1) |
| CAS: | 68134-02-1 |
| EINECS: | 268-723-6 |
| Molecular Formula: | C22H43NO4 |
| Molecular Weight: | 385.5811 |
| InChI: | InChI=1/C18H34O3.C4H9NO/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;1-3-6-4-2-5-1/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);5H,1-4H2/b12-9-;/t17-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 219.8°C |
| Boiling Point: | 416.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 219.8°C |
| Safety Data | |
 |
|
