| Identification |
| Name: | nonanoic acid, compound with morpholine (1:1) |
| Synonyms: | Nonanoic acid, compd. with morpholine (1:1);Pelargonic acid, morpholine salt;Nonanoic acid, compound with morpholine (1:1);nonanoic acid - morpholine (1:1) |
| CAS: | 67952-98-1 |
| EINECS: | 267-935-6 |
| Molecular Formula: | C13H27NO3 |
| Molecular Weight: | 245.3584 |
| InChI: | InChI=1/C9H18O2.C4H9NO/c1-2-3-4-5-6-7-8-9(10)11;1-3-6-4-2-5-1/h2-8H2,1H3,(H,10,11);5H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 114.9°C |
| Boiling Point: | 254.9°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 114.9°C |
| Safety Data |
| |
 |
