Identification |
Name: | nonanoic acid, compound with tributylamine (1:1) |
Synonyms: | Nonanoic acid, compound with tributylamine (1:1);N,N-dibutylbutan-1-aminium nonanoate |
CAS: | 94166-51-5 |
EINECS: | 303-346-3 |
Molecular Formula: | C21H45NO2 |
Molecular Weight: | 343.5875 |
InChI: | InChI=1/C12H27N.C9H18O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-3-4-5-6-7-8-9(10)11/h4-12H2,1-3H3;2-8H2,1H3,(H,10,11) |
Molecular Structure: |
 |
Properties |
Flash Point: | 223.1°C |
Boiling Point: | 445.3°C at 760 mmHg |
Flash Point: | 223.1°C |
Safety Data |
|
 |